C12H17N2O5+ — CID 16678199
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N-methylpyridin-1-ium-3-carboxamide (PubChem CID 16678199) has the molecular formula C12H17N2O5+ and a molecular weight of 269.28 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N-methylpyridin-1-ium-3-carboxamide.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N-methylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 16678199 |
| Molecular Formula | C12H17N2O5+ |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N-methylpyridin-1-ium-3-carboxamide |
| SMILES | CNC(=O)c1ccc[n+]([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C12H16N2O5/c1-13-11(18)7-3-2-4-14(5-7)12-10(17)9(16)8(6-15)19-12/h2-5,8-10,12,15-17H,6H2,1H3/p+1/t8-,9-,10-,12-/m1/s1 |
| InChIKey | UVJRRJBGDVUSJY-DNRKLUKYSA-O |
| XLogP | -2.05 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|