C11H24N2O — CID 166782124
(5S)-5,9-diamino-3,3-dimethylnonan-4-one (PubChem CID 166782124) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is (5S)-5,9-diamino-3,3-dimethylnonan-4-one.
| Compound Name | (5S)-5,9-diamino-3,3-dimethylnonan-4-one |
|---|---|
| PubChem CID | 166782124 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | (5S)-5,9-diamino-3,3-dimethylnonan-4-one |
| SMILES | CCC(C)(C)C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C11H24N2O/c1-4-11(2,3)10(14)9(13)7-5-6-8-12/h9H,4-8,12-13H2,1-3H3/t9-/m0/s1 |
| InChIKey | DIPLBBNBRMUNMK-VIFPVBQESA-N |
| XLogP | 1.45 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|