About 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline
6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline (PubChem CID 166782125) has the molecular formula C19H18ClN3
and a molecular weight of 323.83 g/mol. Its IUPAC name is 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline.
Molecular Properties
| Compound Name | 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline |
| PubChem CID | 166782125 |
| Molecular Formula | C19H18ClN3 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline |
| SMILES | C=C1NC(CN2CCCc3ccccc32)=Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H18ClN3/c1-13-16-11-15(20)8-9-17(16)22-19(21-13)12-23-10-4-6-14-5-2-3-7-18(14)23/h2-3,5,7-9,11H,1,4,6,10,12H2,(H,21,22) |
| InChIKey | WLAQNEVHRLLPNB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline?
The IUPAC name of 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline (CID 166782125) is 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline.
What is the SMILES notation for 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline?
The canonical SMILES for 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline is C=C1NC(CN2CCCc3ccccc32)=Nc2ccc(Cl)cc21.
What is the InChIKey of 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline?
The InChIKey is WLAQNEVHRLLPNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN3/c1-13-16-11-15(20)8-9-17(16)22-19(21-13)12-23-10-4-6-14-5-2-3-7-18(14)23/h2-3,5,7-9,11H,1,4,6,10,12H2,(H,21,22).
What are the key properties of 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline?
6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline has a molecular weight of 323.83 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methylidene-3H-quinazoline is sourced from PubChem (CID 166782125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).