C22H30F2O4 — CID 166782137
2-[(2E,6E)-11,11-difluoro-3,7-dimethylundeca-2,6,10-trienyl]-4-hydroxy-5,6-dimethoxy-3-methylcyclohexa-2,5-dien-1-one (PubChem CID 166782137) has the molecular formula C22H30F2O4 and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-[(2E,6E)-11,11-difluoro-3,7-dimethylundeca-2,6,10-trienyl]-4-hydroxy-5,6-dimethoxy-3-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 2-[(2E,6E)-11,11-difluoro-3,7-dimethylundeca-2,6,10-trienyl]-4-hydroxy-5,6-dimethoxy-3-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 166782137 |
| Molecular Formula | C22H30F2O4 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 2-[(2E,6E)-11,11-difluoro-3,7-dimethylundeca-2,6,10-trienyl]-4-hydroxy-5,6-dimethoxy-3-methylcyclohexa-2,5-dien-1-one |
| SMILES | COC1=C(OC)C(O)C(C)=C(C/C=C(\C)CC/C=C(\C)CCC=C(F)F)C1=O |
| InChI | InChI=1S/C22H30F2O4/c1-14(10-7-11-18(23)24)8-6-9-15(2)12-13-17-16(3)19(25)21(27-4)22(28-5)20(17)26/h8,11-12,19,25H,6-7,9-10,13H2,1-5H3/b14-8+,15-12+ |
| InChIKey | HEWSUMRKMZKDEV-DYHGJXMBSA-N |
| XLogP | 5.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|