C23H28N2O2 — CID 166782167
1-[5-methoxy-2-[1-(3-propan-2-yl-2,3-dihydroindol-1-yl)propan-2-ylideneamino]phenyl]ethanone (PubChem CID 166782167) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[5-methoxy-2-[1-(3-propan-2-yl-2,3-dihydroindol-1-yl)propan-2-ylideneamino]phenyl]ethanone.
| Compound Name | 1-[5-methoxy-2-[1-(3-propan-2-yl-2,3-dihydroindol-1-yl)propan-2-ylideneamino]phenyl]ethanone |
|---|---|
| PubChem CID | 166782167 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-[5-methoxy-2-[1-(3-propan-2-yl-2,3-dihydroindol-1-yl)propan-2-ylideneamino]phenyl]ethanone |
| SMILES | COc1ccc(/N=C(\C)CN2CC(C(C)C)c3ccccc32)c(C(C)=O)c1 |
| InChI | InChI=1S/C23H28N2O2/c1-15(2)21-14-25(23-9-7-6-8-19(21)23)13-16(3)24-22-11-10-18(27-5)12-20(22)17(4)26/h6-12,15,21H,13-14H2,1-5H3/b24-16+ |
| InChIKey | GBYPGVAARFSSRC-LFVJCYFKSA-N |
| XLogP | 5.25 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|