C18H28F3NO3 — CID 166782186
2-methoxy-5-methyl-3-(methylamino)-6-(9,9,9-trifluorononyl)benzene-1,4-diol (PubChem CID 166782186) has the molecular formula C18H28F3NO3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-methoxy-5-methyl-3-(methylamino)-6-(9,9,9-trifluorononyl)benzene-1,4-diol.
| Compound Name | 2-methoxy-5-methyl-3-(methylamino)-6-(9,9,9-trifluorononyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 166782186 |
| Molecular Formula | C18H28F3NO3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-methoxy-5-methyl-3-(methylamino)-6-(9,9,9-trifluorononyl)benzene-1,4-diol |
| SMILES | CNc1c(O)c(C)c(CCCCCCCCC(F)(F)F)c(O)c1OC |
| InChI | InChI=1S/C18H28F3NO3/c1-12-13(16(24)17(25-3)14(22-2)15(12)23)10-8-6-4-5-7-9-11-18(19,20)21/h22-24H,4-11H2,1-3H3 |
| InChIKey | ZGRDTGPGJOAOBW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|