C26H27FN4O3 — CID 166782699
1-[(2R,4R)-4-[10-(4-fluorophenyl)-11-(oxan-4-yl)-2,4,5,10-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaen-12-yl]-2-methyloxolan-2-yl]ethanone (PubChem CID 166782699) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is 1-[(2R,4R)-4-[10-(4-fluorophenyl)-11-(oxan-4-yl)-2,4,5,10-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaen-12-yl]-2-methyloxolan-2-yl]ethanone.
| Compound Name | 1-[(2R,4R)-4-[10-(4-fluorophenyl)-11-(oxan-4-yl)-2,4,5,10-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaen-12-yl]-2-methyloxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 166782699 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 1-[(2R,4R)-4-[10-(4-fluorophenyl)-11-(oxan-4-yl)-2,4,5,10-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaen-12-yl]-2-methyloxolan-2-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)C[C@H](c2c(C3CCOCC3)n(-c3ccc(F)cc3)c3cc4cn[nH]c4nc23)CO1 |
| InChI | InChI=1S/C26H27FN4O3/c1-15(32)26(2)12-18(14-34-26)22-23-21(11-17-13-28-30-25(17)29-23)31(20-5-3-19(27)4-6-20)24(22)16-7-9-33-10-8-16/h3-6,11,13,16,18H,7-10,12,14H2,1-2H3,(H,28,29,30)/t18-,26+/m0/s1 |
| InChIKey | ZKPOTAKYOGRMFJ-HFJWLAOPSA-N |
| XLogP | 4.79 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |