C19H20F2N4O3S — CID 166782783
N-[(E)-1-[2-[4-(difluoromethoxy)phenyl]sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-3-methyl-1-oxopent-3-en-2-yl]formamide (PubChem CID 166782783) has the molecular formula C19H20F2N4O3S and a molecular weight of 422.46 g/mol. Its IUPAC name is N-[(E)-1-[2-[4-(difluoromethoxy)phenyl]sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-3-methyl-1-oxopent-3-en-2-yl]formamide.
| Compound Name | N-[(E)-1-[2-[4-(difluoromethoxy)phenyl]sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-3-methyl-1-oxopent-3-en-2-yl]formamide |
|---|---|
| PubChem CID | 166782783 |
| Molecular Formula | C19H20F2N4O3S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[(E)-1-[2-[4-(difluoromethoxy)phenyl]sulfanyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-3-methyl-1-oxopent-3-en-2-yl]formamide |
| SMILES | C/C=C(\C)C(NC=O)C(=O)N1Cc2cn(Sc3ccc(OC(F)F)cc3)nc2C1 |
| InChI | InChI=1S/C19H20F2N4O3S/c1-3-12(2)17(22-11-26)18(27)24-8-13-9-25(23-16(13)10-24)29-15-6-4-14(5-7-15)28-19(20)21/h3-7,9,11,17,19H,8,10H2,1-2H3,(H,22,26)/b12-3+ |
| InChIKey | OTFARNPWHRFIQF-KGVSQERTSA-N |
| XLogP | 2.96 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|