C20H32N2O2 — CID 166782912
N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carboxamide (PubChem CID 166782912) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166782912 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carboxamide |
| SMILES | C=C/C=C(\C=C/C)CNC(=O)C1CCCN1C(=O)C(C)C(C)(C)C |
| InChI | InChI=1S/C20H32N2O2/c1-7-10-16(11-8-2)14-21-18(23)17-12-9-13-22(17)19(24)15(3)20(4,5)6/h7-8,10-11,15,17H,1,9,12-14H2,2-6H3,(H,21,23)/b11-8-,16-10+ |
| InChIKey | RDKCFORAHRPMQS-CPIFZXGHSA-N |
| XLogP | 3.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|