About N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine
N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine (PubChem CID 166783337) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine.
Molecular Properties
| Compound Name | N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine |
| PubChem CID | 166783337 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine |
| SMILES | C=C(/N=C/C)/C(=C\CC)OC1CC1 |
| InChI | InChI=1S/C11H17NO/c1-4-6-11(9(3)12-5-2)13-10-7-8-10/h5-6,10H,3-4,7-8H2,1-2H3/b11-6+,12-5+ |
| InChIKey | SVEUZJZMPNRRFJ-HFQMJBPSSA-N |
| XLogP | 3.06 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine?
The IUPAC name of N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine (CID 166783337) is N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine.
What is the SMILES notation for N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine?
The canonical SMILES for N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine is C=C(/N=C/C)/C(=C\CC)OC1CC1.
What is the InChIKey of N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine?
The InChIKey is SVEUZJZMPNRRFJ-HFQMJBPSSA-N. The full InChI is InChI=1S/C11H17NO/c1-4-6-11(9(3)12-5-2)13-10-7-8-10/h5-6,10H,3-4,7-8H2,1-2H3/b11-6+,12-5+.
What are the key properties of N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine?
N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine has a molecular weight of 179.26 g/mol, XLogP of 3.06, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-3-cyclopropyloxyhexa-1,3-dien-2-yl]ethanimine is sourced from PubChem (CID 166783337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).