About 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine
4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine (PubChem CID 166783555) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine |
| PubChem CID | 166783555 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine |
| SMILES | Cn1ncc2c(C3CC3)ncnc21 |
| InChI | InChI=1S/C9H10N4/c1-13-9-7(4-12-13)8(6-2-3-6)10-5-11-9/h4-6H,2-3H2,1H3 |
| InChIKey | SRYWDPZPIAJLHA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine?
The IUPAC name of 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine (CID 166783555) is 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine is Cn1ncc2c(C3CC3)ncnc21.
What is the InChIKey of 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine?
The InChIKey is SRYWDPZPIAJLHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c1-13-9-7(4-12-13)8(6-2-3-6)10-5-11-9/h4-6H,2-3H2,1H3.
What are the key properties of 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine?
4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine has a molecular weight of 174.21 g/mol, XLogP of 1.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-1-methylpyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 166783555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).