C15H15ClFNO2 — CID 166783574
methyl 5-[(1Z)-1-chloro-2,3-dimethylbuta-1,3-dienyl]-2-fluoro-4-(methylideneamino)benzoate (PubChem CID 166783574) has the molecular formula C15H15ClFNO2 and a molecular weight of 295.74 g/mol. Its IUPAC name is methyl 5-[(1Z)-1-chloro-2,3-dimethylbuta-1,3-dienyl]-2-fluoro-4-(methylideneamino)benzoate.
| Compound Name | methyl 5-[(1Z)-1-chloro-2,3-dimethylbuta-1,3-dienyl]-2-fluoro-4-(methylideneamino)benzoate |
|---|---|
| PubChem CID | 166783574 |
| Molecular Formula | C15H15ClFNO2 |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | methyl 5-[(1Z)-1-chloro-2,3-dimethylbuta-1,3-dienyl]-2-fluoro-4-(methylideneamino)benzoate |
| SMILES | C=Nc1cc(F)c(C(=O)OC)cc1/C(Cl)=C(\C)C(=C)C |
| InChI | InChI=1S/C15H15ClFNO2/c1-8(2)9(3)14(16)11-6-10(15(19)20-5)12(17)7-13(11)18-4/h6-7H,1,4H2,2-3,5H3/b14-9- |
| InChIKey | XTIGFEKCSZFSKP-ZROIWOOFSA-N |
| XLogP | 4.49 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|