C19H12N6O4S — CID 166783581
1-[2-[(6-nitro-1,3-benzoxazol-2-yl)methylsulfanyl]phenyl]-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 166783581) has the molecular formula C19H12N6O4S and a molecular weight of 420.41 g/mol. Its IUPAC name is 1-[2-[(6-nitro-1,3-benzoxazol-2-yl)methylsulfanyl]phenyl]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-[2-[(6-nitro-1,3-benzoxazol-2-yl)methylsulfanyl]phenyl]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 166783581 |
| Molecular Formula | C19H12N6O4S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 1-[2-[(6-nitro-1,3-benzoxazol-2-yl)methylsulfanyl]phenyl]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1cnn2-c1ccccc1SCc1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C19H12N6O4S/c26-19-12-8-22-24(18(12)20-10-21-19)14-3-1-2-4-16(14)30-9-17-23-13-6-5-11(25(27)28)7-15(13)29-17/h1-8,10H,9H2,(H,20,21,26) |
| InChIKey | ZXYOQATWZRPBAR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|