About 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine
6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine (PubChem CID 166783609) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine.
Molecular Properties
| Compound Name | 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine |
| PubChem CID | 166783609 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine |
| SMILES | CC1=CCC=C2NCC(N)=NC2=C1 |
| InChI | InChI=1S/C10H13N3/c1-7-3-2-4-8-9(5-7)13-10(11)6-12-8/h3-5,12H,2,6H2,1H3,(H2,11,13) |
| InChIKey | BLWMYPGNOKOYPY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine?
The IUPAC name of 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine (CID 166783609) is 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine.
What is the SMILES notation for 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine?
The canonical SMILES for 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine is CC1=CCC=C2NCC(N)=NC2=C1.
What is the InChIKey of 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine?
The InChIKey is BLWMYPGNOKOYPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-7-3-2-4-8-9(5-7)13-10(11)6-12-8/h3-5,12H,2,6H2,1H3,(H2,11,13).
What are the key properties of 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine?
6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine has a molecular weight of 175.23 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,8-dihydro-1H-cyclohepta[b]pyrazin-3-amine is sourced from PubChem (CID 166783609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).