C30H57NO4 — CID 166783620
tert-butyl 2-tert-butyl-4,4,5,5,8,8-hexamethyl-6-[3-(2-methylprop-2-enoylamino)propoxy]nonanoate (PubChem CID 166783620) has the molecular formula C30H57NO4 and a molecular weight of 495.79 g/mol. Its IUPAC name is tert-butyl 2-tert-butyl-4,4,5,5,8,8-hexamethyl-6-[3-(2-methylprop-2-enoylamino)propoxy]nonanoate.
| Compound Name | tert-butyl 2-tert-butyl-4,4,5,5,8,8-hexamethyl-6-[3-(2-methylprop-2-enoylamino)propoxy]nonanoate |
|---|---|
| PubChem CID | 166783620 |
| Molecular Formula | C30H57NO4 |
| Molecular Weight | 495.79 g/mol |
| Exact Mass | 495.43 |
| IUPAC Name | tert-butyl 2-tert-butyl-4,4,5,5,8,8-hexamethyl-6-[3-(2-methylprop-2-enoylamino)propoxy]nonanoate |
| SMILES | C=C(C)C(=O)NCCCOC(CC(C)(C)C)C(C)(C)C(C)(C)CC(C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C30H57NO4/c1-21(2)24(32)31-17-16-18-34-23(20-26(3,4)5)30(14,15)29(12,13)19-22(27(6,7)8)25(33)35-28(9,10)11/h22-23H,1,16-20H2,2-15H3,(H,31,32) |
| InChIKey | GBYLTGWMRMTGGM-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.79 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|