C23H26N5O2+ — CID 16678405
1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-4-aza-1-azoniabicyclo[2.2.2]octane (PubChem CID 16678405) has the molecular formula C23H26N5O2+ and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-4-aza-1-azoniabicyclo[2.2.2]octane.
| Compound Name | 1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-4-aza-1-azoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 16678405 |
| Molecular Formula | C23H26N5O2+ |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-4-aza-1-azoniabicyclo[2.2.2]octane |
| SMILES | c1ccc(COc2nc(OCc3ccccc3)nc([N+]34CCN(CC3)CC4)n2)cc1 |
| InChI | InChI=1S/C23H26N5O2/c1-3-7-19(8-4-1)17-29-22-24-21(28-14-11-27(12-15-28)13-16-28)25-23(26-22)30-18-20-9-5-2-6-10-20/h1-10H,11-18H2/q+1 |
| InChIKey | TZNJFOZZJZSLGR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|