About 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid
4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid (PubChem CID 166784620) has the molecular formula C9H9Cl3NO5PS
and a molecular weight of 380.57 g/mol. Its IUPAC name is 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid.
Molecular Properties
| Compound Name | 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid |
| PubChem CID | 166784620 |
| Molecular Formula | C9H9Cl3NO5PS |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid |
| SMILES | O=C(O)CCCOP(O)(=S)Oc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl3NO5PS/c10-5-4-6(11)9(13-8(5)12)18-19(16,20)17-3-1-2-7(14)15/h4H,1-3H2,(H,14,15)(H,16,20) |
| InChIKey | BNXKBMDPYHTFNL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid?
The IUPAC name of 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid (CID 166784620) is 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid.
What is the SMILES notation for 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid?
The canonical SMILES for 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid is O=C(O)CCCOP(O)(=S)Oc1nc(Cl)c(Cl)cc1Cl.
What is the InChIKey of 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid?
The InChIKey is BNXKBMDPYHTFNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl3NO5PS/c10-5-4-6(11)9(13-8(5)12)18-19(16,20)17-3-1-2-7(14)15/h4H,1-3H2,(H,14,15)(H,16,20).
What are the key properties of 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid?
4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid has a molecular weight of 380.57 g/mol, XLogP of 3.52, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[hydroxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid is sourced from PubChem (CID 166784620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).