C18H20N4O5 — CID 166784806
2-[11-(3,6-dihydro-2H-pyran-4-yl)-2,6-dioxo-5-propan-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid (PubChem CID 166784806) has the molecular formula C18H20N4O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-[11-(3,6-dihydro-2H-pyran-4-yl)-2,6-dioxo-5-propan-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid.
| Compound Name | 2-[11-(3,6-dihydro-2H-pyran-4-yl)-2,6-dioxo-5-propan-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid |
|---|---|
| PubChem CID | 166784806 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-[11-(3,6-dihydro-2H-pyran-4-yl)-2,6-dioxo-5-propan-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid |
| SMILES | CC(C)N1Cc2c(n(CC(=O)O)c3cc(C4=CCOCC4)nn3c2=O)C1=O |
| InChI | InChI=1S/C18H20N4O5/c1-10(2)20-8-12-16(18(20)26)21(9-15(23)24)14-7-13(19-22(14)17(12)25)11-3-5-27-6-4-11/h3,7,10H,4-6,8-9H2,1-2H3,(H,23,24) |
| InChIKey | IRYPJSAGEHZKJD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |