C17H24N+ — CID 166785131
2-(6-methylcyclohepta-1,3,6-trien-1-yl)prop-2-enyl-[(Z)-prop-1-enyl]-propylideneazanium (PubChem CID 166785131) has the molecular formula C17H24N+ and a molecular weight of 242.39 g/mol. Its IUPAC name is 2-(6-methylcyclohepta-1,3,6-trien-1-yl)prop-2-enyl-[(Z)-prop-1-enyl]-propylideneazanium.
| Compound Name | 2-(6-methylcyclohepta-1,3,6-trien-1-yl)prop-2-enyl-[(Z)-prop-1-enyl]-propylideneazanium |
|---|---|
| PubChem CID | 166785131 |
| Molecular Formula | C17H24N+ |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-(6-methylcyclohepta-1,3,6-trien-1-yl)prop-2-enyl-[(Z)-prop-1-enyl]-propylideneazanium |
| SMILES | C=C(C[N+](/C=C\C)=C/CC)C1=CC=CCC(C)=C1 |
| InChI | InChI=1S/C17H24N/c1-5-11-18(12-6-2)14-16(4)17-10-8-7-9-15(3)13-17/h5,7-8,10-13H,4,6,9,14H2,1-3H3/q+1/b11-5-,18-12+ |
| InChIKey | JBQZSJSPFLPUAW-NNFVWJBBSA-N |
| XLogP | 4.40 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|