C8H13NO — CID 166785270
3,5,6,7,8,8a-hexahydro-1H-pyrano[4,3-c]pyridine (PubChem CID 166785270) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 3,5,6,7,8,8a-hexahydro-1H-pyrano[4,3-c]pyridine.
| Compound Name | 3,5,6,7,8,8a-hexahydro-1H-pyrano[4,3-c]pyridine |
|---|---|
| PubChem CID | 166785270 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 3,5,6,7,8,8a-hexahydro-1H-pyrano[4,3-c]pyridine |
| SMILES | C1=C2CNCCC2COC1 |
| InChI | InChI=1S/C8H13NO/c1-3-9-5-7-2-4-10-6-8(1)7/h2,8-9H,1,3-6H2 |
| InChIKey | XXSZROCXOABMBL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|