C22H20ClFN7O2P — CID 166785311
2-[1-[(5-acetyl-2,6-diaminopyrimidin-4-yl)amino]ethyl]-5-chloro-3-(3-fluoro-5-phosphanylphenyl)quinazolin-4-one (PubChem CID 166785311) has the molecular formula C22H20ClFN7O2P and a molecular weight of 499.87 g/mol. Its IUPAC name is 2-[1-[(5-acetyl-2,6-diaminopyrimidin-4-yl)amino]ethyl]-5-chloro-3-(3-fluoro-5-phosphanylphenyl)quinazolin-4-one.
| Compound Name | 2-[1-[(5-acetyl-2,6-diaminopyrimidin-4-yl)amino]ethyl]-5-chloro-3-(3-fluoro-5-phosphanylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 166785311 |
| Molecular Formula | C22H20ClFN7O2P |
| Molecular Weight | 499.87 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-[1-[(5-acetyl-2,6-diaminopyrimidin-4-yl)amino]ethyl]-5-chloro-3-(3-fluoro-5-phosphanylphenyl)quinazolin-4-one |
| SMILES | CC(=O)c1c(N)nc(N)nc1NC(C)c1nc2cccc(Cl)c2c(=O)n1-c1cc(F)cc(P)c1 |
| InChI | InChI=1S/C22H20ClFN7O2P/c1-9(27-19-16(10(2)32)18(25)29-22(26)30-19)20-28-15-5-3-4-14(23)17(15)21(33)31(20)12-6-11(24)7-13(34)8-12/h3-9H,34H2,1-2H3,(H5,25,26,27,29,30) |
| InChIKey | SPMIZBBCABXWRC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|