About 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal
2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal (PubChem CID 166785348) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal.
Molecular Properties
| Compound Name | 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal |
| PubChem CID | 166785348 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal |
| SMILES | C=C(C=O)C1CC/C(C)=C/CCC(C)C(OC)C1 |
| InChI | InChI=1S/C16H26O2/c1-12-6-5-7-13(2)16(18-4)10-15(9-8-12)14(3)11-17/h6,11,13,15-16H,3,5,7-10H2,1-2,4H3/b12-6+ |
| InChIKey | SQISKKFZFXOZFF-WUXMJOGZSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal?
The IUPAC name of 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal (CID 166785348) is 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal.
What is the SMILES notation for 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal?
The canonical SMILES for 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal is C=C(C=O)C1CC/C(C)=C/CCC(C)C(OC)C1.
What is the InChIKey of 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal?
The InChIKey is SQISKKFZFXOZFF-WUXMJOGZSA-N. The full InChI is InChI=1S/C16H26O2/c1-12-6-5-7-13(2)16(18-4)10-15(9-8-12)14(3)11-17/h6,11,13,15-16H,3,5,7-10H2,1-2,4H3/b12-6+.
What are the key properties of 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal?
2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal has a molecular weight of 250.38 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4E)-9-methoxy-4,8-dimethylcyclodec-4-en-1-yl]prop-2-enal is sourced from PubChem (CID 166785348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).