C11H19NO3 — CID 166785647
2-(2-methoxyethoxy)-1-(2,3,6,7-tetrahydroazepin-1-yl)ethanone (PubChem CID 166785647) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-1-(2,3,6,7-tetrahydroazepin-1-yl)ethanone.
| Compound Name | 2-(2-methoxyethoxy)-1-(2,3,6,7-tetrahydroazepin-1-yl)ethanone |
|---|---|
| PubChem CID | 166785647 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2-(2-methoxyethoxy)-1-(2,3,6,7-tetrahydroazepin-1-yl)ethanone |
| SMILES | COCCOCC(=O)N1CCC=CCC1 |
| InChI | InChI=1S/C11H19NO3/c1-14-8-9-15-10-11(13)12-6-4-2-3-5-7-12/h2-3H,4-10H2,1H3 |
| InChIKey | LQQJTTHQHMRTCF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|