C10H7F14NO3 — CID 166785671
2,2-difluoro-2-[1,1,3,3,3-pentafluoro-2-[fluoro-(1,1,2,2,3-pentafluoro-3-methylbutoxy)amino]propoxy]acetyl fluoride (PubChem CID 166785671) has the molecular formula C10H7F14NO3 and a molecular weight of 455.14 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,3,3,3-pentafluoro-2-[fluoro-(1,1,2,2,3-pentafluoro-3-methylbutoxy)amino]propoxy]acetyl fluoride.
| Compound Name | 2,2-difluoro-2-[1,1,3,3,3-pentafluoro-2-[fluoro-(1,1,2,2,3-pentafluoro-3-methylbutoxy)amino]propoxy]acetyl fluoride |
|---|---|
| PubChem CID | 166785671 |
| Molecular Formula | C10H7F14NO3 |
| Molecular Weight | 455.14 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 2,2-difluoro-2-[1,1,3,3,3-pentafluoro-2-[fluoro-(1,1,2,2,3-pentafluoro-3-methylbutoxy)amino]propoxy]acetyl fluoride |
| SMILES | CC(C)(F)C(F)(F)C(F)(F)ON(F)C(C(F)(F)F)C(F)(F)OC(F)(F)C(=O)F |
| InChI | InChI=1S/C10H7F14NO3/c1-5(2,12)9(20,21)10(22,23)28-25(24)3(6(13,14)15)7(16,17)27-8(18,19)4(11)26/h3H,1-2H3 |
| InChIKey | LOPJLSSXTZHKOJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.14 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|