C24H44FNO4 — CID 166785836
(2R,3S,4R)-1-[5-[(4-cyclohexyl-3-fluorocyclohexyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4-diol (PubChem CID 166785836) has the molecular formula C24H44FNO4 and a molecular weight of 429.62 g/mol. Its IUPAC name is (2R,3S,4R)-1-[5-[(4-cyclohexyl-3-fluorocyclohexyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4-diol.
| Compound Name | (2R,3S,4R)-1-[5-[(4-cyclohexyl-3-fluorocyclohexyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 166785836 |
| Molecular Formula | C24H44FNO4 |
| Molecular Weight | 429.62 g/mol |
| Exact Mass | 429.33 |
| IUPAC Name | (2R,3S,4R)-1-[5-[(4-cyclohexyl-3-fluorocyclohexyl)methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4-diol |
| SMILES | OC[C@@H]1[C@H](O)[C@H](O)CCN1CCCCCOCC1CCC(C2CCCCC2)C(F)C1 |
| InChI | InChI=1S/C24H44FNO4/c25-21-15-18(9-10-20(21)19-7-3-1-4-8-19)17-30-14-6-2-5-12-26-13-11-23(28)24(29)22(26)16-27/h18-24,27-29H,1-17H2/t18?,20?,21?,22-,23-,24+/m1/s1 |
| InChIKey | FNPXBGYKIGBMMQ-JSPLQXBTSA-N |
| XLogP | 3.30 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|