About 3-iodo-4-thiophen-2-yl-1,2-oxazole
3-iodo-4-thiophen-2-yl-1,2-oxazole (PubChem CID 166786121) has the molecular formula C7H4INOS
and a molecular weight of 277.09 g/mol. Its IUPAC name is 3-iodo-4-thiophen-2-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-iodo-4-thiophen-2-yl-1,2-oxazole |
| PubChem CID | 166786121 |
| Molecular Formula | C7H4INOS |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 276.91 |
| IUPAC Name | 3-iodo-4-thiophen-2-yl-1,2-oxazole |
| SMILES | Ic1nocc1-c1cccs1 |
| InChI | InChI=1S/C7H4INOS/c8-7-5(4-10-9-7)6-2-1-3-11-6/h1-4H |
| InChIKey | HEMLFBSOIVWGCW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-4-thiophen-2-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-4-thiophen-2-yl-1,2-oxazole?
The IUPAC name of 3-iodo-4-thiophen-2-yl-1,2-oxazole (CID 166786121) is 3-iodo-4-thiophen-2-yl-1,2-oxazole.
What is the SMILES notation for 3-iodo-4-thiophen-2-yl-1,2-oxazole?
The canonical SMILES for 3-iodo-4-thiophen-2-yl-1,2-oxazole is Ic1nocc1-c1cccs1.
What is the InChIKey of 3-iodo-4-thiophen-2-yl-1,2-oxazole?
The InChIKey is HEMLFBSOIVWGCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4INOS/c8-7-5(4-10-9-7)6-2-1-3-11-6/h1-4H.
What are the key properties of 3-iodo-4-thiophen-2-yl-1,2-oxazole?
3-iodo-4-thiophen-2-yl-1,2-oxazole has a molecular weight of 277.09 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-4-thiophen-2-yl-1,2-oxazole is sourced from PubChem (CID 166786121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).