About 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine
1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine (PubChem CID 166786710) has the molecular formula C12H22F2N2
and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine.
Molecular Properties
| Compound Name | 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine |
| PubChem CID | 166786710 |
| Molecular Formula | C12H22F2N2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine |
| SMILES | CC(N1CCC(F)(F)C1)C(C)(C)N1CCC1 |
| InChI | InChI=1S/C12H22F2N2/c1-10(11(2,3)16-6-4-7-16)15-8-5-12(13,14)9-15/h10H,4-9H2,1-3H3 |
| InChIKey | LQVMIVGNWPODGA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine?
The IUPAC name of 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine (CID 166786710) is 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine.
What is the SMILES notation for 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine?
The canonical SMILES for 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine is CC(N1CCC(F)(F)C1)C(C)(C)N1CCC1.
What is the InChIKey of 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine?
The InChIKey is LQVMIVGNWPODGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2N2/c1-10(11(2,3)16-6-4-7-16)15-8-5-12(13,14)9-15/h10H,4-9H2,1-3H3.
What are the key properties of 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine?
1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine has a molecular weight of 232.32 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(azetidin-1-yl)-3-methylbutan-2-yl]-3,3-difluoropyrrolidine is sourced from PubChem (CID 166786710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).