About 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one
1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one (PubChem CID 166786750) has the molecular formula C18H35NO
and a molecular weight of 281.48 g/mol. Its IUPAC name is 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one |
| PubChem CID | 166786750 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one |
| SMILES | CCCCC(C)(C)CC(C(C)CCC)N1CCCC1=O |
| InChI | InChI=1S/C18H35NO/c1-6-8-12-18(4,5)14-16(15(3)10-7-2)19-13-9-11-17(19)20/h15-16H,6-14H2,1-5H3 |
| InChIKey | HTJGGNOTAZIMLQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one?
The IUPAC name of 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one (CID 166786750) is 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one.
What is the SMILES notation for 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one?
The canonical SMILES for 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one is CCCCC(C)(C)CC(C(C)CCC)N1CCCC1=O.
What is the InChIKey of 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one?
The InChIKey is HTJGGNOTAZIMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO/c1-6-8-12-18(4,5)14-16(15(3)10-7-2)19-13-9-11-17(19)20/h15-16H,6-14H2,1-5H3.
What are the key properties of 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one?
1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one has a molecular weight of 281.48 g/mol, XLogP of 5.02, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,7,7-trimethylundecan-5-yl)pyrrolidin-2-one is sourced from PubChem (CID 166786750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).