C13H11F3N4 — CID 166787145
5-amino-2-[(2E,4Z)-6,6,6-trifluoro-5-(methylideneamino)hexa-2,4-dien-2-yl]pyridine-3-carbonitrile (PubChem CID 166787145) has the molecular formula C13H11F3N4 and a molecular weight of 280.25 g/mol. Its IUPAC name is 5-amino-2-[(2E,4Z)-6,6,6-trifluoro-5-(methylideneamino)hexa-2,4-dien-2-yl]pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-[(2E,4Z)-6,6,6-trifluoro-5-(methylideneamino)hexa-2,4-dien-2-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166787145 |
| Molecular Formula | C13H11F3N4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 5-amino-2-[(2E,4Z)-6,6,6-trifluoro-5-(methylideneamino)hexa-2,4-dien-2-yl]pyridine-3-carbonitrile |
| SMILES | C=N/C(=C\C=C(/C)c1ncc(N)cc1C#N)C(F)(F)F |
| InChI | InChI=1S/C13H11F3N4/c1-8(3-4-11(19-2)13(14,15)16)12-9(6-17)5-10(18)7-20-12/h3-5,7H,2,18H2,1H3/b8-3+,11-4- |
| InChIKey | HTMGZNOXQYBHHD-PZQHNSHCSA-N |
| XLogP | 3.09 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|