C25H27N7OS — CID 166787357
ethanimidoyl 3-[[2-(2,7-diazaspiro[3.5]nonan-7-yl)pyridine-4-carbonyl]amino]isoquinoline-6-carboximidothioate (PubChem CID 166787357) has the molecular formula C25H27N7OS and a molecular weight of 473.61 g/mol. Its IUPAC name is ethanimidoyl 3-[[2-(2,7-diazaspiro[3.5]nonan-7-yl)pyridine-4-carbonyl]amino]isoquinoline-6-carboximidothioate.
| Compound Name | ethanimidoyl 3-[[2-(2,7-diazaspiro[3.5]nonan-7-yl)pyridine-4-carbonyl]amino]isoquinoline-6-carboximidothioate |
|---|---|
| PubChem CID | 166787357 |
| Molecular Formula | C25H27N7OS |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | ethanimidoyl 3-[[2-(2,7-diazaspiro[3.5]nonan-7-yl)pyridine-4-carbonyl]amino]isoquinoline-6-carboximidothioate |
| SMILES | [H]/N=C(\S/C(C)=N/[H])c1ccc2cnc(NC(=O)c3ccnc(N4CCC5(CC4)CNC5)c3)cc2c1 |
| InChI | InChI=1S/C25H27N7OS/c1-16(26)34-23(27)17-2-3-19-13-30-21(11-20(19)10-17)31-24(33)18-4-7-29-22(12-18)32-8-5-25(6-9-32)14-28-15-25/h2-4,7,10-13,26-28H,5-6,8-9,14-15H2,1H3,(H,30,31,33)/b26-16+,27-23- |
| InChIKey | MVEBYKBSYHCINF-FIKIEOPKSA-N |
| XLogP | 4.13 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|