C30H23N5O6S — CID 166788284
(3S)-3-[4-[7-[(3S)-2,6-dioxopiperidin-3-yl]-2-methylfuro[2,3-f]indazol-4-yl]-2-methylfuro[2,3-f][1,3]benzothiazol-7-yl]piperidine-2,6-dione (PubChem CID 166788284) has the molecular formula C30H23N5O6S and a molecular weight of 581.61 g/mol. Its IUPAC name is (3S)-3-[4-[7-[(3S)-2,6-dioxopiperidin-3-yl]-2-methylfuro[2,3-f]indazol-4-yl]-2-methylfuro[2,3-f][1,3]benzothiazol-7-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[4-[7-[(3S)-2,6-dioxopiperidin-3-yl]-2-methylfuro[2,3-f]indazol-4-yl]-2-methylfuro[2,3-f][1,3]benzothiazol-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166788284 |
| Molecular Formula | C30H23N5O6S |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | (3S)-3-[4-[7-[(3S)-2,6-dioxopiperidin-3-yl]-2-methylfuro[2,3-f]indazol-4-yl]-2-methylfuro[2,3-f][1,3]benzothiazol-7-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2c(-c3c4cn(C)nc4cc4c([C@@H]5CCC(=O)NC5=O)coc34)c3occ([C@@H]4CCC(=O)NC4=O)c3cc2s1 |
| InChI | InChI=1S/C30H23N5O6S/c1-12-31-26-21(42-12)8-16-19(14-4-6-23(37)33-30(14)39)11-41-28(16)25(26)24-17-9-35(2)34-20(17)7-15-18(10-40-27(15)24)13-3-5-22(36)32-29(13)38/h7-11,13-14H,3-6H2,1-2H3,(H,32,36,38)(H,33,37,39)/t13-,14-/m0/s1 |
| InChIKey | RAARFACJJYPVCU-KBPBESRZSA-N |
| XLogP | 4.69 |
| TPSA | 149.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|