About (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine
(2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine (PubChem CID 166788778) has the molecular formula C11H20FN
and a molecular weight of 185.29 g/mol. Its IUPAC name is (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine |
| PubChem CID | 166788778 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine |
| SMILES | CCC(F)/C(=C\C=C(\C)N)C(C)C |
| InChI | InChI=1S/C11H20FN/c1-5-11(12)10(8(2)3)7-6-9(4)13/h6-8,11H,5,13H2,1-4H3/b9-6-,10-7- |
| InChIKey | RDYHBWFQYMUNHP-LFPVQMOXSA-N |
| XLogP | 3.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine?
The IUPAC name of (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine (CID 166788778) is (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine.
What is the SMILES notation for (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine?
The canonical SMILES for (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine is CCC(F)/C(=C\C=C(\C)N)C(C)C.
What is the InChIKey of (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine?
The InChIKey is RDYHBWFQYMUNHP-LFPVQMOXSA-N. The full InChI is InChI=1S/C11H20FN/c1-5-11(12)10(8(2)3)7-6-9(4)13/h6-8,11H,5,13H2,1-4H3/b9-6-,10-7-.
What are the key properties of (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine?
(2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine has a molecular weight of 185.29 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-6-fluoro-5-propan-2-ylocta-2,4-dien-2-amine is sourced from PubChem (CID 166788778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).