C12H19F3N4 — CID 166789296
7-hexyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 166789296) has the molecular formula C12H19F3N4 and a molecular weight of 276.31 g/mol. Its IUPAC name is 7-hexyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 7-hexyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 166789296 |
| Molecular Formula | C12H19F3N4 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 7-hexyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCCCCCN1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C12H19F3N4/c1-2-3-4-5-6-18-7-8-19-10(9-18)16-17-11(19)12(13,14)15/h2-9H2,1H3 |
| InChIKey | XMJGTTNVUKDBBM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|