C16H23FO9 — CID 166789575
[(2S)-2-fluoro-2-(3,4,5-triacetyloxy-6-methyloxan-2-yl)ethyl] acetate (PubChem CID 166789575) has the molecular formula C16H23FO9 and a molecular weight of 378.35 g/mol. Its IUPAC name is [(2S)-2-fluoro-2-(3,4,5-triacetyloxy-6-methyloxan-2-yl)ethyl] acetate.
| Compound Name | [(2S)-2-fluoro-2-(3,4,5-triacetyloxy-6-methyloxan-2-yl)ethyl] acetate |
|---|---|
| PubChem CID | 166789575 |
| Molecular Formula | C16H23FO9 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [(2S)-2-fluoro-2-(3,4,5-triacetyloxy-6-methyloxan-2-yl)ethyl] acetate |
| SMILES | CC(=O)OC[C@H](F)C1OC(C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C16H23FO9/c1-7-13(24-9(3)19)15(25-10(4)20)16(26-11(5)21)14(23-7)12(17)6-22-8(2)18/h7,12-16H,6H2,1-5H3/t7?,12-,13?,14?,15?,16?/m0/s1 |
| InChIKey | GYGCYFLQLIAZJX-VSZPQXGFSA-N |
| XLogP | 0.47 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|