C15H24N2O4S3 — CID 166789849
(4S,7R,12E)-7-(2-methylsulfanylethyl)-6,9-dioxo-1,2-dithia-5,8-diazacyclopentadec-12-ene-4-carboxylic acid (PubChem CID 166789849) has the molecular formula C15H24N2O4S3 and a molecular weight of 392.57 g/mol. Its IUPAC name is (4S,7R,12E)-7-(2-methylsulfanylethyl)-6,9-dioxo-1,2-dithia-5,8-diazacyclopentadec-12-ene-4-carboxylic acid.
| Compound Name | (4S,7R,12E)-7-(2-methylsulfanylethyl)-6,9-dioxo-1,2-dithia-5,8-diazacyclopentadec-12-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 166789849 |
| Molecular Formula | C15H24N2O4S3 |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (4S,7R,12E)-7-(2-methylsulfanylethyl)-6,9-dioxo-1,2-dithia-5,8-diazacyclopentadec-12-ene-4-carboxylic acid |
| SMILES | CSCC[C@H]1NC(=O)CC/C=C/CCSSC[C@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C15H24N2O4S3/c1-22-9-7-11-14(19)17-12(15(20)21)10-24-23-8-5-3-2-4-6-13(18)16-11/h2-3,11-12H,4-10H2,1H3,(H,16,18)(H,17,19)(H,20,21)/b3-2+/t11-,12-/m1/s1 |
| InChIKey | NLJMMMKRJOMLMG-JGLYPNHGSA-N |
| XLogP | 1.92 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|