C12H12FNO4 — CID 166790516
4-(2-fluorophenyl)pyrrolidine-1,3-dicarboxylic acid (PubChem CID 166790516) has the molecular formula C12H12FNO4 and a molecular weight of 253.23 g/mol. Its IUPAC name is 4-(2-fluorophenyl)pyrrolidine-1,3-dicarboxylic acid.
| Compound Name | 4-(2-fluorophenyl)pyrrolidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 166790516 |
| Molecular Formula | C12H12FNO4 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 4-(2-fluorophenyl)pyrrolidine-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)O)CC1c1ccccc1F |
| InChI | InChI=1S/C12H12FNO4/c13-10-4-2-1-3-7(10)8-5-14(12(17)18)6-9(8)11(15)16/h1-4,8-9H,5-6H2,(H,15,16)(H,17,18) |
| InChIKey | GQIGKZKSOIWILY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |