About [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone
[2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone (PubChem CID 166790938) has the molecular formula C19H13F2NO3
and a molecular weight of 341.31 g/mol. Its IUPAC name is [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone.
Molecular Properties
| Compound Name | [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone |
| PubChem CID | 166790938 |
| Molecular Formula | C19H13F2NO3 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone |
| SMILES | O=C(c1cnc2c(F)cccc2c1)c1cccc(F)c1C1OCCO1 |
| InChI | InChI=1S/C19H13F2NO3/c20-14-5-2-4-13(16(14)19-24-7-8-25-19)18(23)12-9-11-3-1-6-15(21)17(11)22-10-12/h1-6,9-10,19H,7-8H2 |
| InChIKey | MVMITMFVFYDQOS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone?
The IUPAC name of [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone (CID 166790938) is [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone.
What is the SMILES notation for [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone?
The canonical SMILES for [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone is O=C(c1cnc2c(F)cccc2c1)c1cccc(F)c1C1OCCO1.
What is the InChIKey of [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone?
The InChIKey is MVMITMFVFYDQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2NO3/c20-14-5-2-4-13(16(14)19-24-7-8-25-19)18(23)12-9-11-3-1-6-15(21)17(11)22-10-12/h1-6,9-10,19H,7-8H2.
What are the key properties of [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone?
[2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone has a molecular weight of 341.31 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dioxolan-2-yl)-3-fluorophenyl]-(8-fluoroquinolin-3-yl)methanone is sourced from PubChem (CID 166790938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).