C24H33N3O3 — CID 166791829
tert-butyl N-[2-[4-[[1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]methoxy]phenyl]ethyl]carbamate (PubChem CID 166791829) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]methoxy]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[[1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]methoxy]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 166791829 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | tert-butyl N-[2-[4-[[1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]methoxy]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(OCC2CCN(Cc3cccnc3)C2)cc1 |
| InChI | InChI=1S/C24H33N3O3/c1-24(2,3)30-23(28)26-13-10-19-6-8-22(9-7-19)29-18-21-11-14-27(17-21)16-20-5-4-12-25-15-20/h4-9,12,15,21H,10-11,13-14,16-18H2,1-3H3,(H,26,28) |
| InChIKey | WAEKOLWGGLOUGQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |