C23H23FN4O5S — CID 166792590
2-[4-[4-amino-2-(N-(1-amino-1-oxopropan-2-yl)-4-fluoroanilino)-1,3-thiazole-5-carbonyl]phenoxy]ethyl acetate (PubChem CID 166792590) has the molecular formula C23H23FN4O5S and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-[4-[4-amino-2-(N-(1-amino-1-oxopropan-2-yl)-4-fluoroanilino)-1,3-thiazole-5-carbonyl]phenoxy]ethyl acetate.
| Compound Name | 2-[4-[4-amino-2-(N-(1-amino-1-oxopropan-2-yl)-4-fluoroanilino)-1,3-thiazole-5-carbonyl]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 166792590 |
| Molecular Formula | C23H23FN4O5S |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-[4-[4-amino-2-(N-(1-amino-1-oxopropan-2-yl)-4-fluoroanilino)-1,3-thiazole-5-carbonyl]phenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1ccc(C(=O)c2sc(N(c3ccc(F)cc3)C(C)C(N)=O)nc2N)cc1 |
| InChI | InChI=1S/C23H23FN4O5S/c1-13(22(26)31)28(17-7-5-16(24)6-8-17)23-27-21(25)20(34-23)19(30)15-3-9-18(10-4-15)33-12-11-32-14(2)29/h3-10,13H,11-12,25H2,1-2H3,(H2,26,31) |
| InChIKey | SKYVECLCCOZHFZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|