C27H27Cl2N3O — CID 16679329
1-butyl-2-(3,4-dichlorophenyl)-N-(3-phenylpropyl)benzimidazole-5-carboxamide (PubChem CID 16679329) has the molecular formula C27H27Cl2N3O and a molecular weight of 480.44 g/mol. Its IUPAC name is 1-butyl-2-(3,4-dichlorophenyl)-N-(3-phenylpropyl)benzimidazole-5-carboxamide.
| Compound Name | 1-butyl-2-(3,4-dichlorophenyl)-N-(3-phenylpropyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 16679329 |
| Molecular Formula | C27H27Cl2N3O |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 1-butyl-2-(3,4-dichlorophenyl)-N-(3-phenylpropyl)benzimidazole-5-carboxamide |
| SMILES | CCCCn1c(-c2ccc(Cl)c(Cl)c2)nc2cc(C(=O)NCCCc3ccccc3)ccc21 |
| InChI | InChI=1S/C27H27Cl2N3O/c1-2-3-16-32-25-14-12-21(27(33)30-15-7-10-19-8-5-4-6-9-19)18-24(25)31-26(32)20-11-13-22(28)23(29)17-20/h4-6,8-9,11-14,17-18H,2-3,7,10,15-16H2,1H3,(H,30,33) |
| InChIKey | XZAFVMLZENPDQL-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|