C3H7N5S2 — CID 166793466
2,6-diamino-1H-1,3,5-triazine-4-thione;sulfane (PubChem CID 166793466) has the molecular formula C3H7N5S2 and a molecular weight of 177.26 g/mol. Its IUPAC name is 2,6-diamino-1H-1,3,5-triazine-4-thione;sulfane.
| Compound Name | 2,6-diamino-1H-1,3,5-triazine-4-thione;sulfane |
|---|---|
| PubChem CID | 166793466 |
| Molecular Formula | C3H7N5S2 |
| Molecular Weight | 177.26 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 2,6-diamino-1H-1,3,5-triazine-4-thione;sulfane |
| SMILES | Nc1nc(=S)nc(N)[nH]1.S |
| InChI | InChI=1S/C3H5N5S.H2S/c4-1-6-2(5)8-3(9)7-1;/h(H5,4,5,6,7,8,9);1H2 |
| InChIKey | LOTVLLMFNCCJIA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|