C20H16ClFN2O2 — CID 166793626
4-[4-[(4-chloro-3-fluorophenoxy)methyl]-2-pyridinyl]-2-methylbenzamide (PubChem CID 166793626) has the molecular formula C20H16ClFN2O2 and a molecular weight of 370.81 g/mol. Its IUPAC name is 4-[4-[(4-chloro-3-fluorophenoxy)methyl]-2-pyridinyl]-2-methylbenzamide.
| Compound Name | 4-[4-[(4-chloro-3-fluorophenoxy)methyl]-2-pyridinyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 166793626 |
| Molecular Formula | C20H16ClFN2O2 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 4-[4-[(4-chloro-3-fluorophenoxy)methyl]-2-pyridinyl]-2-methylbenzamide |
| SMILES | Cc1cc(-c2cc(COc3ccc(Cl)c(F)c3)ccn2)ccc1C(N)=O |
| InChI | InChI=1S/C20H16ClFN2O2/c1-12-8-14(2-4-16(12)20(23)25)19-9-13(6-7-24-19)11-26-15-3-5-17(21)18(22)10-15/h2-10H,11H2,1H3,(H2,23,25) |
| InChIKey | JDQNKJMRSPGTAW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |