C12H15Cl2F3N4 — CID 166794417
N-[6-chloro-4-(trifluoromethyl)pyridazin-3-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-amine;hydrochloride (PubChem CID 166794417) has the molecular formula C12H15Cl2F3N4 and a molecular weight of 343.18 g/mol. Its IUPAC name is N-[6-chloro-4-(trifluoromethyl)pyridazin-3-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-amine;hydrochloride.
| Compound Name | N-[6-chloro-4-(trifluoromethyl)pyridazin-3-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 166794417 |
| Molecular Formula | C12H15Cl2F3N4 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N-[6-chloro-4-(trifluoromethyl)pyridazin-3-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-amine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cc(Cl)nnc1NC1CC2CNCC2C1 |
| InChI | InChI=1S/C12H14ClF3N4.ClH/c13-10-3-9(12(14,15)16)11(20-19-10)18-8-1-6-4-17-5-7(6)2-8;/h3,6-8,17H,1-2,4-5H2,(H,18,20);1H |
| InChIKey | CZMNTVDMWBBEOD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |