About 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol
2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol (PubChem CID 166794759) has the molecular formula C11H18OS
and a molecular weight of 198.33 g/mol. Its IUPAC name is 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol.
Molecular Properties
| Compound Name | 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol |
| PubChem CID | 166794759 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol |
| SMILES | C=C1C=CSC(C(CC)CO)CC1 |
| InChI | InChI=1S/C11H18OS/c1-3-10(8-12)11-5-4-9(2)6-7-13-11/h6-7,10-12H,2-5,8H2,1H3 |
| InChIKey | DMSLTKDBCXZIHY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol?
The IUPAC name of 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol (CID 166794759) is 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol.
What is the SMILES notation for 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol?
The canonical SMILES for 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol is C=C1C=CSC(C(CC)CO)CC1.
What is the InChIKey of 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol?
The InChIKey is DMSLTKDBCXZIHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18OS/c1-3-10(8-12)11-5-4-9(2)6-7-13-11/h6-7,10-12H,2-5,8H2,1H3.
What are the key properties of 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol?
2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol has a molecular weight of 198.33 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methylidene-3,4-dihydro-2H-thiepin-2-yl)butan-1-ol is sourced from PubChem (CID 166794759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).