C21H30O3 — CID 166794790
(E)-1-(4-methylpent-3-en-2-yloxy)-2-(3,4,7,8-tetrahydro-2H-chromen-4-yl)hex-1-en-3-one (PubChem CID 166794790) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (E)-1-(4-methylpent-3-en-2-yloxy)-2-(3,4,7,8-tetrahydro-2H-chromen-4-yl)hex-1-en-3-one.
| Compound Name | (E)-1-(4-methylpent-3-en-2-yloxy)-2-(3,4,7,8-tetrahydro-2H-chromen-4-yl)hex-1-en-3-one |
|---|---|
| PubChem CID | 166794790 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (E)-1-(4-methylpent-3-en-2-yloxy)-2-(3,4,7,8-tetrahydro-2H-chromen-4-yl)hex-1-en-3-one |
| SMILES | CCCC(=O)/C(=C/OC(C)C=C(C)C)C1CCOC2=C1C=CCC2 |
| InChI | InChI=1S/C21H30O3/c1-5-8-20(22)19(14-24-16(4)13-15(2)3)17-11-12-23-21-10-7-6-9-18(17)21/h6,9,13-14,16-17H,5,7-8,10-12H2,1-4H3/b19-14+ |
| InChIKey | SVXFVXKJUSNYGM-XMHGGMMESA-N |
| XLogP | 5.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|