C18H17FN4OS — CID 166795198
N-[1-(7-fluorocyclohepta-1,4,6-trien-1-yl)-4,5,6,7-tetrahydroindazol-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 166795198) has the molecular formula C18H17FN4OS and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[1-(7-fluorocyclohepta-1,4,6-trien-1-yl)-4,5,6,7-tetrahydroindazol-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[1-(7-fluorocyclohepta-1,4,6-trien-1-yl)-4,5,6,7-tetrahydroindazol-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166795198 |
| Molecular Formula | C18H17FN4OS |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[1-(7-fluorocyclohepta-1,4,6-trien-1-yl)-4,5,6,7-tetrahydroindazol-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCCc2c1cnn2C1=CCC=CC=C1F)c1cscn1 |
| InChI | InChI=1S/C18H17FN4OS/c19-13-5-2-1-3-7-17(13)23-16-8-4-6-14(12(16)9-21-23)22-18(24)15-10-25-11-20-15/h1-2,5,7,9-11,14H,3-4,6,8H2,(H,22,24) |
| InChIKey | GVDCXNJVKOEPSG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |