About (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate
(3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate (PubChem CID 166796197) has the molecular formula C19H28FNO4S
and a molecular weight of 385.50 g/mol. Its IUPAC name is (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate.
Molecular Properties
| Compound Name | (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate |
| PubChem CID | 166796197 |
| Molecular Formula | C19H28FNO4S |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate |
| SMILES | CCC(CCCO)CCOC(=O)CCSc1ccc(F)cc1NC(C)=O |
| InChI | InChI=1S/C19H28FNO4S/c1-3-15(5-4-10-22)8-11-25-19(24)9-12-26-18-7-6-16(20)13-17(18)21-14(2)23/h6-7,13,15,22H,3-5,8-12H2,1-2H3,(H,21,23) |
| InChIKey | JEOZVARGMJJITA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate?
The IUPAC name of (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate (CID 166796197) is (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate.
What is the SMILES notation for (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate?
The canonical SMILES for (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate is CCC(CCCO)CCOC(=O)CCSc1ccc(F)cc1NC(C)=O.
What is the InChIKey of (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate?
The InChIKey is JEOZVARGMJJITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28FNO4S/c1-3-15(5-4-10-22)8-11-25-19(24)9-12-26-18-7-6-16(20)13-17(18)21-14(2)23/h6-7,13,15,22H,3-5,8-12H2,1-2H3,(H,21,23).
What are the key properties of (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate?
(3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate has a molecular weight of 385.50 g/mol, XLogP of 4.00, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-6-hydroxyhexyl) 3-(2-acetamido-4-fluorophenyl)sulfanylpropanoate is sourced from PubChem (CID 166796197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).