About 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one
3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one (PubChem CID 166796228) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one.
Molecular Properties
| Compound Name | 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one |
| PubChem CID | 166796228 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one |
| SMILES | C=C(C)/C=C/CN1CNCC1=O |
| InChI | InChI=1S/C9H14N2O/c1-8(2)4-3-5-11-7-10-6-9(11)12/h3-4,10H,1,5-7H2,2H3/b4-3+ |
| InChIKey | YYLOMFINQLKDCV-ONEGZZNKSA-N |
| XLogP | 0.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one?
The IUPAC name of 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one (CID 166796228) is 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one.
What is the SMILES notation for 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one?
The canonical SMILES for 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one is C=C(C)/C=C/CN1CNCC1=O.
What is the InChIKey of 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one?
The InChIKey is YYLOMFINQLKDCV-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H14N2O/c1-8(2)4-3-5-11-7-10-6-9(11)12/h3-4,10H,1,5-7H2,2H3/b4-3+.
What are the key properties of 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one?
3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one has a molecular weight of 166.22 g/mol, XLogP of 0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2E)-4-methylpenta-2,4-dienyl]imidazolidin-4-one is sourced from PubChem (CID 166796228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).