About 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine
4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine (PubChem CID 166796477) has the molecular formula C16H22FNO
and a molecular weight of 263.36 g/mol. Its IUPAC name is 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine.
Molecular Properties
| Compound Name | 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine |
| PubChem CID | 166796477 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine |
| SMILES | C=CCCC(=C)C1=CC(F)=C(N2CCOCC2)CC1 |
| InChI | InChI=1S/C16H22FNO/c1-3-4-5-13(2)14-6-7-16(15(17)12-14)18-8-10-19-11-9-18/h3,12H,1-2,4-11H2 |
| InChIKey | SZEIDSCDAFBMOY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine?
The IUPAC name of 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine (CID 166796477) is 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine.
What is the SMILES notation for 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine?
The canonical SMILES for 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine is C=CCCC(=C)C1=CC(F)=C(N2CCOCC2)CC1.
What is the InChIKey of 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine?
The InChIKey is SZEIDSCDAFBMOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FNO/c1-3-4-5-13(2)14-6-7-16(15(17)12-14)18-8-10-19-11-9-18/h3,12H,1-2,4-11H2.
What are the key properties of 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine?
4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine has a molecular weight of 263.36 g/mol, XLogP of 3.74, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoro-4-hexa-1,5-dien-2-ylcyclohexa-1,3-dien-1-yl)morpholine is sourced from PubChem (CID 166796477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).