About 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol
6-heptan-3-ylcyclohexa-1,3-diene-1-thiol (PubChem CID 166797315) has the molecular formula C13H22S
and a molecular weight of 210.39 g/mol. Its IUPAC name is 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol.
Molecular Properties
| Compound Name | 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol |
| PubChem CID | 166797315 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol |
| SMILES | CCCCC(CC)C1CC=CC=C1S |
| InChI | InChI=1S/C13H22S/c1-3-5-8-11(4-2)12-9-6-7-10-13(12)14/h6-7,10-12,14H,3-5,8-9H2,1-2H3 |
| InChIKey | OXCKIRJANCMPOY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol?
The IUPAC name of 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol (CID 166797315) is 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol.
What is the SMILES notation for 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol?
The canonical SMILES for 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol is CCCCC(CC)C1CC=CC=C1S.
What is the InChIKey of 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol?
The InChIKey is OXCKIRJANCMPOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22S/c1-3-5-8-11(4-2)12-9-6-7-10-13(12)14/h6-7,10-12,14H,3-5,8-9H2,1-2H3.
What are the key properties of 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol?
6-heptan-3-ylcyclohexa-1,3-diene-1-thiol has a molecular weight of 210.39 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-heptan-3-ylcyclohexa-1,3-diene-1-thiol is sourced from PubChem (CID 166797315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).